C26H24N4O6S2 — CID 25042087
4-[3-[benzenesulfonyl-[2-(1H-indol-3-yl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 25042087) has the molecular formula C26H24N4O6S2 and a molecular weight of 552.63 g/mol. Its IUPAC name is 4-[3-[benzenesulfonyl-[2-(1H-indol-3-yl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[benzenesulfonyl-[2-(1H-indol-3-yl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25042087 |
| Molecular Formula | C26H24N4O6S2 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 4-[3-[benzenesulfonyl-[2-(1H-indol-3-yl)ethyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(CCc3c[nH]c4ccccc34)S(=O)(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24N4O6S2/c27-37(33,34)20-12-10-19(11-13-20)30-25(31)16-24(26(30)32)29(38(35,36)21-6-2-1-3-7-21)15-14-18-17-28-23-9-5-4-8-22(18)23/h1-13,17,24,28H,14-16H2,(H2,27,33,34) |
| InChIKey | DCIBWOOYWMWQFV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|