C28H24N4O5S — CID 23743623
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 23743623) has the molecular formula C28H24N4O5S and a molecular weight of 528.59 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 23743623 |
| Molecular Formula | C28H24N4O5S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCc2c[nH]c3ccccc23)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H24N4O5S/c1-37-22-10-12-23(13-11-22)38(35,36)31(15-14-20-18-30-25-5-3-2-4-24(20)25)26-16-27(33)32(28(26)34)21-8-6-19(17-29)7-9-21/h2-13,18,26,30H,14-16H2,1H3 |
| InChIKey | MVSKPWQPFWUVCT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|