C26H24N4O7S2 — CID 25034702
4-[2-[[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-(4-methoxyphenyl)sulfonylamino]ethyl]benzenesulfonamide (PubChem CID 25034702) has the molecular formula C26H24N4O7S2 and a molecular weight of 568.63 g/mol. Its IUPAC name is 4-[2-[[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-(4-methoxyphenyl)sulfonylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-(4-methoxyphenyl)sulfonylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25034702 |
| Molecular Formula | C26H24N4O7S2 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 4-[2-[[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-(4-methoxyphenyl)sulfonylamino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCc2ccc(S(N)(=O)=O)cc2)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24N4O7S2/c1-37-21-8-12-23(13-9-21)39(35,36)29(15-14-18-4-10-22(11-5-18)38(28,33)34)24-16-25(31)30(26(24)32)20-6-2-19(17-27)3-7-20/h2-13,24H,14-16H2,1H3,(H2,28,33,34) |
| InChIKey | FVJDAXGQWNJHQW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 167.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|