C25H25N3O7S2 — CID 25037912
4-[3-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 25037912) has the molecular formula C25H25N3O7S2 and a molecular weight of 543.62 g/mol. Its IUPAC name is 4-[3-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25037912 |
| Molecular Formula | C25H25N3O7S2 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 4-[3-[(4-methoxyphenyl)sulfonyl-(2-phenylethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCc2ccccc2)C2CC(=O)N(c3ccc(S(N)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O7S2/c1-35-20-9-13-22(14-10-20)37(33,34)27(16-15-18-5-3-2-4-6-18)23-17-24(29)28(25(23)30)19-7-11-21(12-8-19)36(26,31)32/h2-14,23H,15-17H2,1H3,(H2,26,31,32) |
| InChIKey | HITPPGQUZGYKNF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|