C23H20ClN3O6S2 — CID 25038329
4-[3-[benzyl-(4-chlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 25038329) has the molecular formula C23H20ClN3O6S2 and a molecular weight of 534.02 g/mol. Its IUPAC name is 4-[3-[benzyl-(4-chlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[benzyl-(4-chlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25038329 |
| Molecular Formula | C23H20ClN3O6S2 |
| Molecular Weight | 534.02 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | 4-[3-[benzyl-(4-chlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3ccccc3)S(=O)(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H20ClN3O6S2/c24-17-6-10-20(11-7-17)35(32,33)26(15-16-4-2-1-3-5-16)21-14-22(28)27(23(21)29)18-8-12-19(13-9-18)34(25,30)31/h1-13,21H,14-15H2,(H2,25,30,31) |
| InChIKey | LHKGLAUQSZIJAJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.02 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|