C23H19IN2O4S — CID 23886751
N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23886751) has the molecular formula C23H19IN2O4S and a molecular weight of 546.39 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23886751 |
| Molecular Formula | C23H19IN2O4S |
| Molecular Weight | 546.39 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | O=C1CC(N(Cc2ccccc2)S(=O)(=O)c2ccccc2)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C23H19IN2O4S/c24-18-11-13-19(14-12-18)26-22(27)15-21(23(26)28)25(16-17-7-3-1-4-8-17)31(29,30)20-9-5-2-6-10-20/h1-14,21H,15-16H2 |
| InChIKey | ORPGRVIHTKIOCH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|