C21H17IN2O4S2 — CID 23801812
N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 23801812) has the molecular formula C21H17IN2O4S2 and a molecular weight of 552.42 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23801812 |
| Molecular Formula | C21H17IN2O4S2 |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 551.97 |
| IUPAC Name | N-benzyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | O=C1CC(N(Cc2ccccc2)S(=O)(=O)c2cccs2)C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C21H17IN2O4S2/c22-16-8-10-17(11-9-16)24-19(25)13-18(21(24)26)23(14-15-5-2-1-3-6-15)30(27,28)20-7-4-12-29-20/h1-12,18H,13-14H2 |
| InChIKey | HLCGVWQSIZDUOX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|