C26H26FN3O4S2 — CID 23772872
N-(1-benzylpiperidin-4-yl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 23772872) has the molecular formula C26H26FN3O4S2 and a molecular weight of 527.64 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23772872 |
| Molecular Formula | C26H26FN3O4S2 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | O=C1CC(N(C2CCN(Cc3ccccc3)CC2)S(=O)(=O)c2cccs2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26FN3O4S2/c27-20-8-10-21(11-9-20)29-24(31)17-23(26(29)32)30(36(33,34)25-7-4-16-35-25)22-12-14-28(15-13-22)18-19-5-2-1-3-6-19/h1-11,16,22-23H,12-15,17-18H2 |
| InChIKey | AAVUQAAHOQESKZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|