C19H22N2O4S2 — CID 23772810
N-tert-butyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 23772810) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-tert-butyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-tert-butyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23772810 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-tert-butyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(C(C)(C)C)S(=O)(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C19H22N2O4S2/c1-13-7-9-14(10-8-13)20-16(22)12-15(18(20)23)21(19(2,3)4)27(24,25)17-6-5-11-26-17/h5-11,15H,12H2,1-4H3 |
| InChIKey | ZJAZXHOFPAKPBV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|