C24H29IN2O4S — CID 23914825
N-tert-butyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 23914825) has the molecular formula C24H29IN2O4S and a molecular weight of 568.48 g/mol. Its IUPAC name is N-tert-butyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-tert-butyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23914825 |
| Molecular Formula | C24H29IN2O4S |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | N-tert-butyl-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N(C2CC(=O)N(c3ccc(I)cc3)C2=O)C(C)(C)C)c1C |
| InChI | InChI=1S/C24H29IN2O4S/c1-14-12-15(2)17(4)22(16(14)3)32(30,31)27(24(5,6)7)20-13-21(28)26(23(20)29)19-10-8-18(25)9-11-19/h8-12,20H,13H2,1-7H3 |
| InChIKey | VRWNJJGRXJUYRK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|