C20H22FN3O6S2 — CID 25049106
4-[3-[tert-butyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 25049106) has the molecular formula C20H22FN3O6S2 and a molecular weight of 483.54 g/mol. Its IUPAC name is 4-[3-[tert-butyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[tert-butyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25049106 |
| Molecular Formula | C20H22FN3O6S2 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 4-[3-[tert-butyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | CC(C)(C)N(C1CC(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FN3O6S2/c1-20(2,3)24(32(29,30)16-8-4-13(21)5-9-16)17-12-18(25)23(19(17)26)14-6-10-15(11-7-14)31(22,27)28/h4-11,17H,12H2,1-3H3,(H2,22,27,28) |
| InChIKey | JNPOLQDWQNCRBZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|