C21H24FN3O6S2 — CID 25044948
4-[3-[(4-fluorophenyl)sulfonyl-(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 25044948) has the molecular formula C21H24FN3O6S2 and a molecular weight of 497.57 g/mol. Its IUPAC name is 4-[3-[(4-fluorophenyl)sulfonyl-(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(4-fluorophenyl)sulfonyl-(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25044948 |
| Molecular Formula | C21H24FN3O6S2 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 4-[3-[(4-fluorophenyl)sulfonyl-(2-methylbutan-2-yl)amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | CCC(C)(C)N(C1CC(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN3O6S2/c1-4-21(2,3)25(33(30,31)17-9-5-14(22)6-10-17)18-13-19(26)24(20(18)27)15-7-11-16(12-8-15)32(23,28)29/h5-12,18H,4,13H2,1-3H3,(H2,23,28,29) |
| InChIKey | YWOOFEQUNAJYDB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|