C22H25IN2O5S — CID 23830578
N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N-(2-methylbutan-2-yl)benzenesulfonamide (PubChem CID 23830578) has the molecular formula C22H25IN2O5S and a molecular weight of 556.42 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N-(2-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N-(2-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 23830578 |
| Molecular Formula | C22H25IN2O5S |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N-(2-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)(C)N(C1CC(=O)N(c2ccc(I)cc2)C1=O)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H25IN2O5S/c1-5-22(2,3)25(31(28,29)18-12-10-17(30-4)11-13-18)19-14-20(26)24(21(19)27)16-8-6-15(23)7-9-16/h6-13,19H,5,14H2,1-4H3 |
| InChIKey | QPNJYYIAQLNSFW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|