C25H30N2O6S — CID 23830750
N-cyclohexyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide (PubChem CID 23830750) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is N-cyclohexyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide.
| Compound Name | N-cyclohexyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 23830750 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-cyclohexyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxybenzenesulfonamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(C3CCCCC3)S(=O)(=O)c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H30N2O6S/c1-3-33-21-11-9-18(10-12-21)26-24(28)17-23(25(26)29)27(19-7-5-4-6-8-19)34(30,31)22-15-13-20(32-2)14-16-22/h9-16,19,23H,3-8,17H2,1-2H3 |
| InChIKey | NNAWXZDNTFADLZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|