C27H31N3O7S — CID 23772649
methyl 4-[3-[(4-acetamidophenyl)sulfonyl-cycloheptylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23772649) has the molecular formula C27H31N3O7S and a molecular weight of 541.63 g/mol. Its IUPAC name is methyl 4-[3-[(4-acetamidophenyl)sulfonyl-cycloheptylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[(4-acetamidophenyl)sulfonyl-cycloheptylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23772649 |
| Molecular Formula | C27H31N3O7S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | methyl 4-[3-[(4-acetamidophenyl)sulfonyl-cycloheptylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(C3CCCCCC3)S(=O)(=O)c3ccc(NC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H31N3O7S/c1-18(31)28-20-11-15-23(16-12-20)38(35,36)30(22-7-5-3-4-6-8-22)24-17-25(32)29(26(24)33)21-13-9-19(10-14-21)27(34)37-2/h9-16,22,24H,3-8,17H2,1-2H3,(H,28,31) |
| InChIKey | HKVUYMVGGWEXRN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|