C23H22Cl2N2O6S — CID 23886758
methyl 4-[3-[cyclopentyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23886758) has the molecular formula C23H22Cl2N2O6S and a molecular weight of 525.41 g/mol. Its IUPAC name is methyl 4-[3-[cyclopentyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[cyclopentyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23886758 |
| Molecular Formula | C23H22Cl2N2O6S |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | methyl 4-[3-[cyclopentyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(C3CCCC3)S(=O)(=O)c3cc(Cl)ccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O6S/c1-33-23(30)14-6-9-16(10-7-14)26-21(28)13-19(22(26)29)27(17-4-2-3-5-17)34(31,32)20-12-15(24)8-11-18(20)25/h6-12,17,19H,2-5,13H2,1H3 |
| InChIKey | QPGWKLYMVCVYDR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|