C21H18Cl2N2O6S — CID 23942798
[4-[3-[(2,5-dichlorophenyl)sulfonyl-prop-2-enylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23942798) has the molecular formula C21H18Cl2N2O6S and a molecular weight of 497.36 g/mol. Its IUPAC name is [4-[3-[(2,5-dichlorophenyl)sulfonyl-prop-2-enylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[(2,5-dichlorophenyl)sulfonyl-prop-2-enylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23942798 |
| Molecular Formula | C21H18Cl2N2O6S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | [4-[3-[(2,5-dichlorophenyl)sulfonyl-prop-2-enylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | C=CCN(C1CC(=O)N(c2ccc(OC(C)=O)cc2)C1=O)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O6S/c1-3-10-24(32(29,30)19-11-14(22)4-9-17(19)23)18-12-20(27)25(21(18)28)15-5-7-16(8-6-15)31-13(2)26/h3-9,11,18H,1,10,12H2,2H3 |
| InChIKey | QRWAWEDHPDIOSN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|