C23H26N2O9S — CID 23970745
[4-[3-[2,2-dimethoxyethyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23970745) has the molecular formula C23H26N2O9S and a molecular weight of 506.53 g/mol. Its IUPAC name is [4-[3-[2,2-dimethoxyethyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[2,2-dimethoxyethyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23970745 |
| Molecular Formula | C23H26N2O9S |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | [4-[3-[2,2-dimethoxyethyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(OC)OC)C2CC(=O)N(c3ccc(OC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N2O9S/c1-15(26)34-18-7-5-16(6-8-18)25-21(27)13-20(23(25)28)24(14-22(32-3)33-4)35(29,30)19-11-9-17(31-2)10-12-19/h5-12,20,22H,13-14H2,1-4H3 |
| InChIKey | XPRWETWSGADECT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|