C24H25N3O8S2 — CID 25046261
N-(2,2-dimethoxyethyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]naphthalene-2-sulfonamide (PubChem CID 25046261) has the molecular formula C24H25N3O8S2 and a molecular weight of 547.61 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]naphthalene-2-sulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25046261 |
| Molecular Formula | C24H25N3O8S2 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]naphthalene-2-sulfonamide |
| SMILES | COC(CN(C1CC(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O)S(=O)(=O)c1ccc2ccccc2c1)OC |
| InChI | InChI=1S/C24H25N3O8S2/c1-34-23(35-2)15-26(37(32,33)20-10-7-16-5-3-4-6-17(16)13-20)21-14-22(28)27(24(21)29)18-8-11-19(12-9-18)36(25,30)31/h3-13,21,23H,14-15H2,1-2H3,(H2,25,30,31) |
| InChIKey | BGJLWCDQEHQSSQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|