C28H26ClN3O6S2 — CID 23998639
4-chloro-N-(2,2-dimethoxyethyl)-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23998639) has the molecular formula C28H26ClN3O6S2 and a molecular weight of 600.12 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethoxyethyl)-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(2,2-dimethoxyethyl)-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23998639 |
| Molecular Formula | C28H26ClN3O6S2 |
| Molecular Weight | 600.12 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | 4-chloro-N-(2,2-dimethoxyethyl)-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | COC(CN(C1CC(=O)N(c2ccc(-c3nc4ccc(C)cc4s3)cc2)C1=O)S(=O)(=O)c1ccc(Cl)cc1)OC |
| InChI | InChI=1S/C28H26ClN3O6S2/c1-17-4-13-22-24(14-17)39-27(30-22)18-5-9-20(10-6-18)32-25(33)15-23(28(32)34)31(16-26(37-2)38-3)40(35,36)21-11-7-19(29)8-12-21/h4-14,23,26H,15-16H2,1-3H3 |
| InChIKey | VESFKAKQEHZFLO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 106.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.12 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|