C30H28BrN3O4S2 — CID 23886862
4-bromo-N-cyclohexyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23886862) has the molecular formula C30H28BrN3O4S2 and a molecular weight of 638.61 g/mol. Its IUPAC name is 4-bromo-N-cyclohexyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-cyclohexyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23886862 |
| Molecular Formula | C30H28BrN3O4S2 |
| Molecular Weight | 638.61 g/mol |
| Exact Mass | 637.07 |
| IUPAC Name | 4-bromo-N-cyclohexyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)CC(N(C5CCCCC5)S(=O)(=O)c5ccc(Br)cc5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C30H28BrN3O4S2/c1-19-7-16-25-27(17-19)39-29(32-25)20-8-12-22(13-9-20)33-28(35)18-26(30(33)36)34(23-5-3-2-4-6-23)40(37,38)24-14-10-21(31)11-15-24/h7-17,23,26H,2-6,18H2,1H3 |
| InChIKey | XVONWWJHFXNUPT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|