C31H35N3O3S — CID 23859326
N-cyclohexyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide (PubChem CID 23859326) has the molecular formula C31H35N3O3S and a molecular weight of 529.71 g/mol. Its IUPAC name is N-cyclohexyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide.
| Compound Name | N-cyclohexyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 23859326 |
| Molecular Formula | C31H35N3O3S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-cyclohexyl-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)CC(N(C(=O)C5CCCCC5)C5CCCCC5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C31H35N3O3S/c1-20-12-17-25-27(18-20)38-29(32-25)21-13-15-24(16-14-21)34-28(35)19-26(31(34)37)33(23-10-6-3-7-11-23)30(36)22-8-4-2-5-9-22/h12-18,22-23,26H,2-11,19H2,1H3 |
| InChIKey | KBWJQTJWOSYVGH-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|