C31H28FN3O3S — CID 23832302
N-cyclohexyl-4-fluoro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide (PubChem CID 23832302) has the molecular formula C31H28FN3O3S and a molecular weight of 541.65 g/mol. Its IUPAC name is N-cyclohexyl-4-fluoro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide.
| Compound Name | N-cyclohexyl-4-fluoro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23832302 |
| Molecular Formula | C31H28FN3O3S |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | N-cyclohexyl-4-fluoro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)CC(N(C(=O)c5ccc(F)cc5)C5CCCCC5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C31H28FN3O3S/c1-19-7-16-25-27(17-19)39-29(33-25)20-10-14-24(15-11-20)35-28(36)18-26(31(35)38)34(23-5-3-2-4-6-23)30(37)21-8-12-22(32)13-9-21/h7-17,23,26H,2-6,18H2,1H3 |
| InChIKey | WUOFXTZEEMCLCW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|