C23H27N3O8S — CID 23942934
N-[4-[2,2-dimethoxyethyl-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfamoyl]phenyl]acetamide (PubChem CID 23942934) has the molecular formula C23H27N3O8S and a molecular weight of 505.55 g/mol. Its IUPAC name is N-[4-[2,2-dimethoxyethyl-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[2,2-dimethoxyethyl-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23942934 |
| Molecular Formula | C23H27N3O8S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[4-[2,2-dimethoxyethyl-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(N2C(=O)CC(N(CC(OC)OC)S(=O)(=O)c3ccc(NC(C)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O8S/c1-15(27)24-16-5-11-19(12-6-16)35(30,31)25(14-22(33-3)34-4)20-13-21(28)26(23(20)29)17-7-9-18(32-2)10-8-17/h5-12,20,22H,13-14H2,1-4H3,(H,24,27) |
| InChIKey | ACKKGOIYUVKRPI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|