C22H23N3O5S — CID 23886878
N-[4-[[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-prop-2-enylsulfamoyl]phenyl]acetamide (PubChem CID 23886878) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[4-[[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-prop-2-enylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-prop-2-enylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23886878 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[4-[[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-prop-2-enylsulfamoyl]phenyl]acetamide |
| SMILES | C=CCN(C1CC(=O)N(c2ccc(C)cc2)C1=O)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c1-4-13-24(31(29,30)19-11-7-17(8-12-19)23-16(3)26)20-14-21(27)25(22(20)28)18-9-5-15(2)6-10-18/h4-12,20H,1,13-14H2,2-3H3,(H,23,26) |
| InChIKey | IJSKXCPWNQENAZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|