C23H20FN3O6S — CID 23743595
N-[4-[3-[(4-fluorophenyl)sulfonyl-(furan-2-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 23743595) has the molecular formula C23H20FN3O6S and a molecular weight of 485.49 g/mol. Its IUPAC name is N-[4-[3-[(4-fluorophenyl)sulfonyl-(furan-2-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[(4-fluorophenyl)sulfonyl-(furan-2-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 23743595 |
| Molecular Formula | C23H20FN3O6S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | N-[4-[3-[(4-fluorophenyl)sulfonyl-(furan-2-ylmethyl)amino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(Cc3ccco3)S(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H20FN3O6S/c1-15(28)25-17-6-8-18(9-7-17)27-22(29)13-21(23(27)30)26(14-19-3-2-12-33-19)34(31,32)20-10-4-16(24)5-11-20/h2-12,21H,13-14H2,1H3,(H,25,28) |
| InChIKey | YMHVAGBSCWXZMF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|