C22H16ClN3O5S — CID 23942870
4-chloro-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 23942870) has the molecular formula C22H16ClN3O5S and a molecular weight of 469.91 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23942870 |
| Molecular Formula | C22H16ClN3O5S |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 4-chloro-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(N2C(=O)CC(N(Cc3ccco3)S(=O)(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H16ClN3O5S/c23-16-5-9-19(10-6-16)32(29,30)25(14-18-2-1-11-31-18)20-12-21(27)26(22(20)28)17-7-3-15(13-24)4-8-17/h1-11,20H,12,14H2 |
| InChIKey | UMSYEABIZFVYTB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|