C24H23FN2O5S — CID 23743564
N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 23743564) has the molecular formula C24H23FN2O5S and a molecular weight of 470.52 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23743564 |
| Molecular Formula | C24H23FN2O5S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-4-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | CC(C)c1ccc(N2C(=O)CC(N(Cc3ccco3)S(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H23FN2O5S/c1-16(2)17-5-9-19(10-6-17)27-23(28)14-22(24(27)29)26(15-20-4-3-13-32-20)33(30,31)21-11-7-18(25)8-12-21/h3-13,16,22H,14-15H2,1-2H3 |
| InChIKey | RNDJVUXVPRHVAI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|