C23H20FN3O6S2 — CID 25036315
4-[3-[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 25036315) has the molecular formula C23H20FN3O6S2 and a molecular weight of 517.56 g/mol. Its IUPAC name is 4-[3-[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25036315 |
| Molecular Formula | C23H20FN3O6S2 |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 4-[3-[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3ccc(F)cc3)S(=O)(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H20FN3O6S2/c24-17-8-6-16(7-9-17)15-26(35(32,33)20-4-2-1-3-5-20)21-14-22(28)27(23(21)29)18-10-12-19(13-11-18)34(25,30)31/h1-13,21H,14-15H2,(H2,25,30,31) |
| InChIKey | QCLJVAYWNKVPPK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|