C24H20BrFN2O5S — CID 23970658
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(4-fluorophenyl)methyl]-4-methoxybenzenesulfonamide (PubChem CID 23970658) has the molecular formula C24H20BrFN2O5S and a molecular weight of 547.40 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(4-fluorophenyl)methyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(4-fluorophenyl)methyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 23970658 |
| Molecular Formula | C24H20BrFN2O5S |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(4-fluorophenyl)methyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC(=O)N(c3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H20BrFN2O5S/c1-33-20-10-12-21(13-11-20)34(31,32)27(15-16-2-6-18(26)7-3-16)22-14-23(29)28(24(22)30)19-8-4-17(25)5-9-19/h2-13,22H,14-15H2,1H3 |
| InChIKey | FWGMLCVPHUDVCF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|