C26H23FN2O7S — CID 23801820
methyl 4-[3-[(4-fluorophenyl)methyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23801820) has the molecular formula C26H23FN2O7S and a molecular weight of 526.54 g/mol. Its IUPAC name is methyl 4-[3-[(4-fluorophenyl)methyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[(4-fluorophenyl)methyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23801820 |
| Molecular Formula | C26H23FN2O7S |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | methyl 4-[3-[(4-fluorophenyl)methyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc(F)cc3)S(=O)(=O)c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23FN2O7S/c1-35-21-11-13-22(14-12-21)37(33,34)28(16-17-3-7-19(27)8-4-17)23-15-24(30)29(25(23)31)20-9-5-18(6-10-20)26(32)36-2/h3-14,23H,15-16H2,1-2H3 |
| InChIKey | XGEHUEUJVCANJR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|