C22H23FN2O6S — CID 23743521
methyl 4-[3-[tert-butyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23743521) has the molecular formula C22H23FN2O6S and a molecular weight of 462.50 g/mol. Its IUPAC name is methyl 4-[3-[tert-butyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[tert-butyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23743521 |
| Molecular Formula | C22H23FN2O6S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | methyl 4-[3-[tert-butyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(C(C)(C)C)S(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H23FN2O6S/c1-22(2,3)25(32(29,30)17-11-7-15(23)8-12-17)18-13-19(26)24(20(18)27)16-9-5-14(6-10-16)21(28)31-4/h5-12,18H,13H2,1-4H3 |
| InChIKey | ATNHLIKTUSCTDO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|