C22H22Cl2N2O6S — CID 23743520
methyl 4-[3-[tert-butyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23743520) has the molecular formula C22H22Cl2N2O6S and a molecular weight of 513.40 g/mol. Its IUPAC name is methyl 4-[3-[tert-butyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[tert-butyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23743520 |
| Molecular Formula | C22H22Cl2N2O6S |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | methyl 4-[3-[tert-butyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(C(C)(C)C)S(=O)(=O)c3cc(Cl)ccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C22H22Cl2N2O6S/c1-22(2,3)26(33(30,31)18-11-14(23)7-10-16(18)24)17-12-19(27)25(20(17)28)15-8-5-13(6-9-15)21(29)32-4/h5-11,17H,12H2,1-4H3 |
| InChIKey | BXIMOYSKAJQZSQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|