C23H26N2O7S — CID 23858978
methyl 4-[3-[tert-butyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23858978) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is methyl 4-[3-[tert-butyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[tert-butyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23858978 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | methyl 4-[3-[tert-butyl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(C(C)(C)C)S(=O)(=O)c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N2O7S/c1-23(2,3)25(33(29,30)18-12-10-17(31-4)11-13-18)19-14-20(26)24(21(19)27)16-8-6-15(7-9-16)22(28)32-5/h6-13,19H,14H2,1-5H3 |
| InChIKey | PRCVUBIYRBPOPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|