C23H27N3O6S — CID 23914922
N-[4-[3-[butan-2-yl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 23914922) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is N-[4-[3-[butan-2-yl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[butan-2-yl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 23914922 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-[4-[3-[butan-2-yl-(4-methoxyphenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CCC(C)N(C1CC(=O)N(c2ccc(NC(C)=O)cc2)C1=O)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H27N3O6S/c1-5-15(2)26(33(30,31)20-12-10-19(32-4)11-13-20)21-14-22(28)25(23(21)29)18-8-6-17(7-9-18)24-16(3)27/h6-13,15,21H,5,14H2,1-4H3,(H,24,27) |
| InChIKey | GELCXZSYVHGMOZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|