C27H27N3O6 — CID 27871428
3-(4-methoxyphenyl)-1-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]urea (PubChem CID 27871428) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 3-(4-methoxyphenyl)-1-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 27871428 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CN(C(=O)Nc2ccc(OC)cc2)[C@H]2CC(=O)N(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H27N3O6/c1-34-21-10-4-18(5-11-21)17-29(27(33)28-19-6-12-22(35-2)13-7-19)24-16-25(31)30(26(24)32)20-8-14-23(36-3)15-9-20/h4-15,24H,16-17H2,1-3H3,(H,28,33)/t24-/m0/s1 |
| InChIKey | JQUJAFFDVYKGQT-DEOSSOPVSA-N |
| XLogP | 4.08 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|