C24H19F2N3O3 — CID 4038274
1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]urea (PubChem CID 4038274) has the molecular formula C24H19F2N3O3 and a molecular weight of 435.43 g/mol. Its IUPAC name is 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 4038274 |
| Molecular Formula | C24H19F2N3O3 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C1CC(N(Cc2ccc(F)cc2)C(=O)Nc2ccc(F)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H19F2N3O3/c25-17-8-6-16(7-9-17)15-28(24(32)27-19-12-10-18(26)11-13-19)21-14-22(30)29(23(21)31)20-4-2-1-3-5-20/h1-13,21H,14-15H2,(H,27,32) |
| InChIKey | QFXKLDRFMOEQFW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|