C26H25N3O5 — CID 4545161
1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]-3-phenylurea (PubChem CID 4545161) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]-3-phenylurea.
| Compound Name | 1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 4545161 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-1-[(4-methoxyphenyl)methyl]-3-phenylurea |
| SMILES | COc1ccc(CN(C(=O)Nc2ccccc2)C2CC(=O)N(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H25N3O5/c1-33-21-12-8-18(9-13-21)17-28(26(32)27-19-6-4-3-5-7-19)23-16-24(30)29(25(23)31)20-10-14-22(34-2)15-11-20/h3-15,23H,16-17H2,1-2H3,(H,27,32) |
| InChIKey | MLYULPULNYEQKD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|