C28H29N3O5S — CID 3308688
1-[2-(3,4-dimethoxyphenyl)ethyl]-1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-phenylthiourea (PubChem CID 3308688) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-phenylthiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 3308688 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-phenylthiourea |
| SMILES | COc1ccc(N2C(=O)CC(N(CCc3ccc(OC)c(OC)c3)C(=S)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H29N3O5S/c1-34-22-12-10-21(11-13-22)31-26(32)18-23(27(31)33)30(28(37)29-20-7-5-4-6-8-20)16-15-19-9-14-24(35-2)25(17-19)36-3/h4-14,17,23H,15-16,18H2,1-3H3,(H,29,37) |
| InChIKey | UNQNRKLSYFPCFN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|