C26H31N3O6 — CID 23998874
N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide (PubChem CID 23998874) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide.
| Compound Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 23998874 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]butanamide |
| SMILES | CCCC(=O)N(CCc1ccc(OC)c(OC)c1)C1CC(=O)N(c2ccc(NC(C)=O)cc2)C1=O |
| InChI | InChI=1S/C26H31N3O6/c1-5-6-24(31)28(14-13-18-7-12-22(34-3)23(15-18)35-4)21-16-25(32)29(26(21)33)20-10-8-19(9-11-20)27-17(2)30/h7-12,15,21H,5-6,13-14,16H2,1-4H3,(H,27,30) |
| InChIKey | HELOPTGCQUKFGN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|