C27H31N3O5 — CID 23998892
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3,3-dimethylbutanamide (PubChem CID 23998892) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23998892 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(CCN(C(=O)CC(C)(C)C)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C27H31N3O5/c1-27(2,3)16-25(32)29(13-12-18-8-11-22(34-4)23(14-18)35-5)21-15-24(31)30(26(21)33)20-9-6-19(17-28)7-10-20/h6-11,14,21H,12-13,15-16H2,1-5H3 |
| InChIKey | IIUYEMYBGMADPO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|