C26H23N3O5S — CID 23943161
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 23943161) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23943161 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(CCN(C(=O)c2cccs2)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C26H23N3O5S/c1-33-21-10-7-17(14-22(21)34-2)11-12-28(26(32)23-4-3-13-35-23)20-15-24(30)29(25(20)31)19-8-5-18(16-27)6-9-19/h3-10,13-14,20H,11-12,15H2,1-2H3 |
| InChIKey | IJIJUCCDDDBGMK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|