C24H24N2O6S2 — CID 23886722
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)thiophene-2-sulfonamide (PubChem CID 23886722) has the molecular formula C24H24N2O6S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23886722 |
| Molecular Formula | C24H24N2O6S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)thiophene-2-sulfonamide |
| SMILES | COc1ccc(CCN(C2CC(=O)N(c3ccccc3)C2=O)S(=O)(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C24H24N2O6S2/c1-31-20-11-10-17(15-21(20)32-2)12-13-25(34(29,30)23-9-6-14-33-23)19-16-22(27)26(24(19)28)18-7-4-3-5-8-18/h3-11,14-15,19H,12-13,16H2,1-2H3 |
| InChIKey | QWIJABOUOAMUJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|