C27H27FN2O7S — CID 23772820
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-fluoro-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23772820) has the molecular formula C27H27FN2O7S and a molecular weight of 542.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-fluoro-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-fluoro-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23772820 |
| Molecular Formula | C27H27FN2O7S |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-fluoro-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(N2C(=O)CC(N(CCc3ccc(OC)c(OC)c3)S(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H27FN2O7S/c1-35-21-9-7-20(8-10-21)30-26(31)17-23(27(30)32)29(38(33,34)22-11-5-19(28)6-12-22)15-14-18-4-13-24(36-2)25(16-18)37-3/h4-13,16,23H,14-15,17H2,1-3H3 |
| InChIKey | ROZVKVCVNJGQIX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|