C23H26N2O5 — CID 1109209
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]propanamide (PubChem CID 1109209) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 1109209 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]propanamide |
| SMILES | CCC(=O)N(CCc1ccc(OC)c(OC)c1)[C@@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H26N2O5/c1-4-21(26)24(13-12-16-10-11-19(29-2)20(14-16)30-3)18-15-22(27)25(23(18)28)17-8-6-5-7-9-17/h5-11,14,18H,4,12-13,15H2,1-3H3/t18-/m1/s1 |
| InChIKey | PPBRYZFTPCGSRN-GOSISDBHSA-N |
| XLogP | 2.82 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|