C23H20N2O7S2 — CID 23743670
N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 23743670) has the molecular formula C23H20N2O7S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23743670 |
| Molecular Formula | C23H20N2O7S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)S(=O)(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C23H20N2O7S2/c1-30-17-7-5-16(6-8-17)25-21(26)12-18(23(25)27)24(34(28,29)22-3-2-10-33-22)13-15-4-9-19-20(11-15)32-14-31-19/h2-11,18H,12-14H2,1H3 |
| InChIKey | XPQKNCHKTDXGMP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|