C17H19NO4S2 — CID 17457424
N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylthiophene-2-sulfonamide (PubChem CID 17457424) has the molecular formula C17H19NO4S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylthiophene-2-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 17457424 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylthiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1cccs1)N(Cc1ccc2c(c1)OCO2)C1CCCC1 |
| InChI | InChI=1S/C17H19NO4S2/c19-24(20,17-6-3-9-23-17)18(14-4-1-2-5-14)11-13-7-8-15-16(10-13)22-12-21-15/h3,6-10,14H,1-2,4-5,11-12H2 |
| InChIKey | XQIHAYYFTAXEEW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |