C15H15NO5S2 — CID 22422237
N-(1,3-benzodioxol-5-ylmethyl)-3-thiophen-2-ylsulfonylpropanamide (PubChem CID 22422237) has the molecular formula C15H15NO5S2 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-thiophen-2-ylsulfonylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-thiophen-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 22422237 |
| Molecular Formula | C15H15NO5S2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-thiophen-2-ylsulfonylpropanamide |
| SMILES | O=C(CCS(=O)(=O)c1cccs1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H15NO5S2/c17-14(5-7-23(18,19)15-2-1-6-22-15)16-9-11-3-4-12-13(8-11)21-10-20-12/h1-4,6,8H,5,7,9-10H2,(H,16,17) |
| InChIKey | PLNQSQBOZMLLQL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |