C21H21N3O7S — CID 23250885
N-(1,3-benzodioxol-5-ylmethyl)-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonylpropanamide (PubChem CID 23250885) has the molecular formula C21H21N3O7S and a molecular weight of 459.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonylpropanamide |
|---|---|
| PubChem CID | 23250885 |
| Molecular Formula | C21H21N3O7S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)sulfonylpropanamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(S(=O)(=O)CCC(=O)NCc3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C21H21N3O7S/c1-23-15-5-4-14(10-16(15)24(2)21(27)20(23)26)32(28,29)8-7-19(25)22-11-13-3-6-17-18(9-13)31-12-30-17/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,22,25) |
| InChIKey | CRMCZSNHOAKSKN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|