C15H16N2O3 — CID 3238528
N-(1,3-benzodioxol-5-ylmethyl)-3-pyrrol-1-ylpropanamide (PubChem CID 3238528) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-pyrrol-1-ylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-pyrrol-1-ylpropanamide |
|---|---|
| PubChem CID | 3238528 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-pyrrol-1-ylpropanamide |
| SMILES | O=C(CCn1cccc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16N2O3/c18-15(5-8-17-6-1-2-7-17)16-10-12-3-4-13-14(9-12)20-11-19-13/h1-4,6-7,9H,5,8,10-11H2,(H,16,18) |
| InChIKey | FVHLTBLINOUVHZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |